|
CAS#: 89970-78-5 Product: Sodium 4-hydroxy-1-piperidinecarbodithioate No suppilers available for the product. |
| Name | Sodium 4-hydroxy-1-piperidinecarbodithioate |
|---|---|
| Synonyms | 4-Hydroxypiperidine-N-dithiocarboxylate; HP-N-Dtc |
| Molecular Structure | ![]() |
| Molecular Formula | C6H10NNaOS2 |
| Molecular Weight | 199.27 |
| CAS Registry Number | 89970-78-5 |
| SMILES | [Na+].S=C([S-])N1CCC(O)CC1 |
| InChI | 1S/C6H11NOS2.Na/c8-5-1-3-7(4-2-5)6(9)10;/h5,8H,1-4H2,(H,9,10);/q;+1/p-1 |
| InChIKey | YPVKLEKSSJSAOZ-UHFFFAOYSA-M |
| Boiling point | 281.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 124.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 4-hydroxy-1-piperidinecarbodithioate |