|
CAS#: 89992-14-3 Product: N-(2-Aminoethyl)-6-[(4-methylphenyl)amino]-2-naphthalenesulfonamide No suppilers available for the product. |
| Name | N-(2-Aminoethyl)-6-[(4-methylphenyl)amino]-2-naphthalenesulfonamide |
|---|---|
| Synonyms | 2-4-Toluidinylnaphthalene-6-(N-β-ethylamine)sulfonamide; TNEAS |
| Molecular Structure | ![]() |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.45 |
| CAS Registry Number | 89992-14-3 |
| SMILES | O=S(=O)(NCCN)c2ccc1cc(ccc1c2)Nc3ccc(cc3)C |
| InChI | 1S/C19H21N3O2S/c1-14-2-6-17(7-3-14)22-18-8-4-16-13-19(9-5-15(16)12-18)25(23,24)21-11-10-20/h2-9,12-13,21-22H,10-11,20H2,1H3 |
| InChIKey | PIHQIZMWQPFRLK-UHFFFAOYSA-N |
| Density | 1.285g/cm3 (Cal.) |
|---|---|
| Boiling point | 591.581°C at 760 mmHg (Cal.) |
| Flash point | 311.577°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Aminoethyl)-6-[(4-methylphenyl)amino]-2-naphthalenesulfonamide |