|
CAS#: 90029-73-5 Product: 9-(3-Oxoprop-1-enyl)adenine No suppilers available for the product. |
| Name | 9-(3-Oxoprop-1-enyl)adenine |
|---|---|
| Synonyms | (E)-3-(6-Amino-9-Purinyl)Prop-2-Enal; (E)-3-(6-Aminopurin-9-Yl)Acrolein; Adenine Propenal |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7N5O |
| Molecular Weight | 189.18 |
| CAS Registry Number | 90029-73-5 |
| SMILES | C1=NC2=C([N]1\C=C\C=O)N=CN=C2N |
| InChI | 1S/C8H7N5O/c9-7-6-8(11-4-10-7)13(5-12-6)2-1-3-14/h1-5H,(H2,9,10,11)/b2-1+ |
| InChIKey | LYXOMQKQLZJTQN-OWOJBTEDSA-N |
| Density | 1.534g/cm3 (Cal.) |
|---|---|
| Boiling point | 486.835°C at 760 mmHg (Cal.) |
| Flash point | 248.229°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-(3-Oxoprop-1-enyl)adenine |