|
CAS#: 90065-35-3 Product: (7S,11bS)-2-Methyl-7-Phenyl-1,3,4,6,7,11b-Hexahydropyrazino[2,1-a]Isoquinoline No suppilers available for the product. |
| Name | (7S,11bS)-2-Methyl-7-Phenyl-1,3,4,6,7,11b-Hexahydropyrazino[2,1-a]Isoquinoline |
|---|---|
| Synonyms | 1,3,4,6,7,11B-Hexahydro-2-Methyl-7-Phenyl-2H-Pyrazino(2,1-A)Isoquinoline; 2H-Pyrazino(2,1-A)Isoquinoline, 1,3,4,6,7,11B-Hexahydro-2-Methyl-7-Phenyl-, Trans; Hmppiq |
| Molecular Structure | ![]() |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 |
| CAS Registry Number | 90065-35-3 |
| SMILES | [C@H]14N(C[C@H](C2=C1C=CC=C2)C3=CC=CC=C3)CCN(C4)C |
| InChI | 1S/C19H22N2/c1-20-11-12-21-13-18(15-7-3-2-4-8-15)16-9-5-6-10-17(16)19(21)14-20/h2-10,18-19H,11-14H2,1H3/t18-,19+/m0/s1 |
| InChIKey | JWDCLQHNIUCQJT-RBUKOAKNSA-N |
| Density | 1.155g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.808°C at 760 mmHg (Cal.) |
| Flash point | 186.365°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (7S,11bS)-2-Methyl-7-Phenyl-1,3,4,6,7,11b-Hexahydropyrazino[2,1-a]Isoquinoline |