|
CAS#: 90087-84-6 Product: 3-Methylbicyclo[2.2.1]hept-5-ene-2-sulfonamide No suppilers available for the product. |
| Name | 3-Methylbicyclo[2.2.1]hept-5-ene-2-sulfonamide |
|---|---|
| Synonyms | 3-methylbicyclo[2.2.1]hept-5-ene-2-sulfonamide |
| Molecular Structure | ![]() |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 |
| CAS Registry Number | 90087-84-6 |
| SMILES | CC1C2CC(C1S(=O)(=O)N)C=C2 |
| InChI | 1S/C8H13NO2S/c1-5-6-2-3-7(4-6)8(5)12(9,10)11/h2-3,5-8H,4H2,1H3,(H2,9,10,11) |
| InChIKey | XHPMGZGOOPIGCP-UHFFFAOYSA-N |
| Density | 1.309g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.848°C at 760 mmHg (Cal.) |
| Flash point | 150.868°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methylbicyclo[2.2.1]hept-5-ene-2-sulfonamide |