| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | Ethenylbenzene copolymer with (1-methylethenyl)benzene |
|---|---|
| Synonyms | Benzene, Ethenyl-, Polymer With (1-Methylethenyl)Benzene, Hydrogenated; Isopropenylbenzene; Styrene; Ethenylbenzene; Prop-1-En-2-Ylbenzene |
| Molecular Formula | C17H18 |
| Molecular Weight | 222.33 |
| CAS Registry Number | 9011-11-4 (68441-37-2) |
| SMILES | C1=C(C(=C)C)C=CC=C1.C2=C(C=CC=C2)C=C |
| InChI | 1S/C9H10.C8H8/c1-8(2)9-6-4-3-5-7-9;1-2-8-6-4-3-5-7-8/h3-7H,1H2,2H3;2-7H,1H2 |
| InChIKey | ZAKVZVDDGSFVRG-UHFFFAOYSA-N |
| Boiling point | 162.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 45.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethenylbenzene copolymer with (1-methylethenyl)benzene |