|
CAS#: 90149-40-9 Product: N,N'-Bis(2-pyridylmethylene)-1,4-butanediamine (N,N',N'',N''')-Cu(II)diperchlorate No suppilers available for the product. |
| Name | N,N'-Bis(2-pyridylmethylene)-1,4-butanediamine (N,N',N'',N''')-Cu(II)diperchlorate |
|---|---|
| Synonyms | Copper 1-(2-Pyridyl)-N-[4-(2-Pyridylmethyleneamino)Butyl]Methanimine Perchlorate; Cupric 2-Pyridylmethylene-[4-(2-Pyridylmethyleneamino)Butyl]Amine Perchlorate; Cu-Pupy |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18ClCuN4O4 |
| Molecular Weight | 429.34 |
| CAS Registry Number | 90149-40-9 |
| SMILES | [Cl]([O-])(=O)(=O)=O.C(N=CC1=CC=CC=N1)CCCN=CC2=CC=CC=N2.[Cu++] |
| InChI | 1S/C16H18N4.ClHO4.Cu/c1-3-11-19-15(7-1)13-17-9-5-6-10-18-14-16-8-2-4-12-20-16;2-1(3,4)5;/h1-4,7-8,11-14H,5-6,9-10H2;(H,2,3,4,5);/q;;+2/p-1 |
| InChIKey | AQQUYLFVOLEKCP-UHFFFAOYSA-M |
| Boiling point | 452.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 227.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N'-Bis(2-pyridylmethylene)-1,4-butanediamine (N,N',N'',N''')-Cu(II)diperchlorate |