Online Database of Chemicals from Around the World
|
CAS#: 90212-02-5 Product: 19-Mercaptoandrost-4-ene-3,17-dione No suppilers available for the product. |
| Name | 19-Mercaptoandrost-4-ene-3,17-dione |
|---|---|
| Synonyms | (8S,9S,10S,13S,14S)-10-(Mercaptomethyl)-13-Methyl-2,6,7,8,9,11,12,14,15,16-Decahydro-1H-Cyclopenta[A]Phenanthrene-3,17-Dione; (8S,9S,10S,13S,14S)-10-(Mercaptomethyl)-13-Methyl-2,6,7,8,9,11,12,14,15,16-Decahydro-1H-Cyclopenta[A]Phenanthrene-3,17-Quinone; 19- |
| Molecular Structure |  |
| Molecular Formula | C19H26O2S |
| Molecular Weight | 318.47 |
| CAS Registry Number | 90212-02-5 |
| SMILES | [C@@H]23CCC1=CC(CC[C@@]1([C@H]2CC[C@]4([C@H]3CCC4=O)C)CS)=O |
| InChI | 1S/C19H26O2S/c1-18-8-7-16-14(15(18)4-5-17(18)21)3-2-12-10-13(20)6-9-19(12,16)11-22/h10,14-16,22H,2-9,11H2,1H3/t14-,15-,16-,18-,19+/m0/s1 |
| InChIKey | KNNWZTLIWIMQIQ-BGJMDTOESA-N |
| Density | 1.179g/cm3 (Cal.) |
|---|---|
| Boiling point | 486.396°C at 760 mmHg (Cal.) |
| Flash point | 247.963°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 19-Mercaptoandrost-4-ene-3,17-dione |