|
CAS#: 902137-95-5 Product: 1-[4-(4-Thiomorpholinylsulfonyl)phenyl]ethanone No suppilers available for the product. |
| Name | 1-[4-(4-Thiomorpholinylsulfonyl)phenyl]ethanone |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H15NO3S2 |
| Molecular Weight | 285.38 |
| CAS Registry Number | 902137-95-5 |
| SMILES | O=S(=O)(N1CCSCC1)c2ccc(cc2)C(C)=O |
| InChI | 1S/C12H15NO3S2/c1-10(14)11-2-4-12(5-3-11)18(15,16)13-6-8-17-9-7-13/h2-5H,6-9H2,1H3 |
| InChIKey | MHKYDSXPPIQXFY-UHFFFAOYSA-N |
| Density | 1.323g/cm3 (Cal.) |
|---|---|
| Boiling point | 474.998°C at 760 mmHg (Cal.) |
| Flash point | 241.07°C (Cal.) |
| Refractive index | 1.594 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[4-(4-Thiomorpholinylsulfonyl)phenyl]ethanone |