|
CAS#: 90297-52-2 Product: Olivoretin No suppilers available for the product. |
| Name | Olivoretin |
|---|---|
| Synonyms | Olivoretin; Olivoretin A; Olivoretin B |
| Molecular Structure | ![]() |
| Molecular Formula | C29H43N3O2 |
| Molecular Weight | 465.68 |
| CAS Registry Number | 90297-52-2 |
| SMILES | [C@@]2(C1=CC4=C3C(=C1[C@](CC2)(C=C)C)[NH]C=C3C[C@H](NC([C@@H](N4C)C(C)C)=O)COC)(C(C)C)C |
| InChI | 1S/C29H43N3O2/c1-10-28(6)11-12-29(7,18(4)5)21-14-22-23-19(15-30-25(23)24(21)28)13-20(16-34-9)31-27(33)26(17(2)3)32(22)8/h10,14-15,17-18,20,26,30H,1,11-13,16H2,2-9H3,(H,31,33)/t20-,26-,28-,29+/m0/s1 |
| InChIKey | HQINLFPKZPQGGD-ZVYOULDASA-N |
| Density | 1.057g/cm3 (Cal.) |
|---|---|
| Boiling point | 646.258°C at 760 mmHg (Cal.) |
| Flash point | 344.645°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Olivoretin |