|
CAS#: 903-30-0 Product: 2-(10,13-Dimethyl-3-oxo-2,3,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)propanal No suppilers available for the product. |
| Name | 2-(10,13-Dimethyl-3-oxo-2,3,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)propanal |
|---|---|
| Synonyms | 2-(10,13- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.49 |
| CAS Registry Number | 903-30-0 |
| SMILES | O=CC(C1CCC2C4C(CCC12C)C3(/C(=C\C(=O)CC3)CC4)C)C |
| InChI | 1S/C22H32O2/c1-14(13-23)18-6-7-19-17-5-4-15-12-16(24)8-10-21(15,2)20(17)9-11-22(18,19)3/h12-14,17-20H,4-11H2,1-3H3 |
| InChIKey | XVPJEGGIGJLDQK-UHFFFAOYSA-N |
| Density | 1.074g/cm3 (Cal.) |
|---|---|
| Boiling point | 459.432°C at 760 mmHg (Cal.) |
| Flash point | 170.979°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(10,13-Dimethyl-3-oxo-2,3,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)propanal |