|
CAS#: 90347-61-8 Product: 6-Iodo-9-(thiolan-2-yl)purine No suppilers available for the product. |
| Name | 6-Iodo-9-(thiolan-2-yl)purine |
|---|---|
| Synonyms | 6-Iodo-9-Tetrahydrothiophen-2-Yl-Purine; 6-Iodo-9-(2-Tetrahydrothiophenyl)Purine; Nsc56935 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9IN4S |
| Molecular Weight | 332.16 |
| CAS Registry Number | 90347-61-8 |
| SMILES | C2=NC1=C(N=CN=C1I)[N]2C3CCCS3 |
| InChI | 1S/C9H9IN4S/c10-8-7-9(12-4-11-8)14(5-13-7)6-2-1-3-15-6/h4-6H,1-3H2 |
| InChIKey | HERRCYLCJRVSEA-UHFFFAOYSA-N |
| Density | 2.229g/cm3 (Cal.) |
|---|---|
| Boiling point | 489.082°C at 760 mmHg (Cal.) |
| Flash point | 249.588°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Iodo-9-(thiolan-2-yl)purine |