Online Database of Chemicals from Around the World
|
CAS#: 90426-22-5 Product: 3',5'-Dimethoxy-4'-hydroxy-(2-hydroxy)acetophenone No suppilers available for the product. |
| Name | 3',5'-Dimethoxy-4'-hydroxy-(2-hydroxy)acetophenone |
|---|---|
| Synonyms | 2-Hydroxy-1-(4-Hydroxy-3,5-Dimethoxy-Phenyl)Ethanone; Danielone; Ethanone, 2-Hydroxy-1-(4-Hydroxy-3,5-Dimethoxyphenyl)- |
| Molecular Structure |  |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 |
| CAS Registry Number | 90426-22-5 |
| SMILES | C1=C(C(=C(C=C1C(=O)CO)OC)O)OC |
| InChI | 1S/C10H12O5/c1-14-8-3-6(7(12)5-11)4-9(15-2)10(8)13/h3-4,11,13H,5H2,1-2H3 |
| InChIKey | ZTBAPEIDNUHRNC-UHFFFAOYSA-N |
| Density | 1.287g/cm3 (Cal.) |
|---|---|
| Boiling point | 390.796°C at 760 mmHg (Cal.) |
| Flash point | 155.819°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3',5'-Dimethoxy-4'-hydroxy-(2-hydroxy)acetophenone |