|
CAS#: 9052-61-3 Product: Vinyltoluene, butadiene polymer No suppilers available for the product. |
| Name | Vinyltoluene, butadiene polymer |
|---|---|
| Synonyms | Buta-1,3-Diene; 1-Methyl-2-Vinyl-Benzene; Buta-1,3-Diene; 1-Methyl-2-Vinylbenzene; Buta-1,3-Diene; 1-Ethenyl-2-Methyl-Benzene |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 |
| CAS Registry Number | 9052-61-3 |
| SMILES | C1=C(C(=CC=C1)C)C=C.C(C=C)=C |
| InChI | 1S/C9H10.C4H6/c1-3-9-7-5-4-6-8(9)2;1-3-4-2/h3-7H,1H2,2H3;3-4H,1-2H2 |
| InChIKey | CRTVERUZDDIKGY-UHFFFAOYSA-N |
| Boiling point | 169.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 44.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Vinyltoluene, butadiene polymer |