Online Database of Chemicals from Around the World
|
CAS#: 90563-18-1 Product: N-[[[(4-aminophenyl)sulphonyl]amino]iminomethyl]acetamide No suppilers available for the product. |
| Name | N-[[[(4-aminophenyl)sulphonyl]amino]iminomethyl]acetamide |
|---|---|
| Synonyms | N-[[N'-(4-Aminophenyl)Sulfonylhydrazino]Methylene]Acetamide; N-[[2-(4-Aminophenyl)Sulfonylhydrazinyl]Methylidene]Ethanamide |
| Molecular Structure | ![CAS#: 90563-18-1, N-[[[(4-aminophenyl)sulphonyl]amino]iminomethyl]acetamide](/moreStructures/90563-18-1.gif) |
| Molecular Formula | C9H12N4O3S |
| Molecular Weight | 256.28 |
| CAS Registry Number | 90563-18-1 |
| EINECS | 292-201-7 |
| SMILES | C1=C([S](=O)(=O)NNC=NC(=O)C)C=CC(=C1)N |
| InChI | 1S/C9H12N4O3S/c1-7(14)11-6-12-13-17(15,16)9-4-2-8(10)3-5-9/h2-6,13H,10H2,1H3,(H,11,12,14) |
| InChIKey | UIYBBJNTRSQPLG-UHFFFAOYSA-N |
| Density | 1.451g/cm3 (Cal.) |
|---|---|
| Boiling point | 460.972°C at 760 mmHg (Cal.) |
| Flash point | 232.588°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[[[(4-aminophenyl)sulphonyl]amino]iminomethyl]acetamide |