Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054//+86 13424336463 | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-[4-(4-Aminophenyl)-2-furyl]ethanone |
|---|---|
| Synonyms | 1-(4-(4-aminophenyl)furan-2-yl)ethanone |
| Molecular Structure | ![CAS#: 906070-63-1, 1-[4-(4-Aminophenyl)-2-furyl]ethanone](/moreStructures/906070-63-1.gif) |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22 |
| CAS Registry Number | 906070-63-1 |
| SMILES | CC(=O)c1cc(co1)c2ccc(cc2)N |
| InChI | 1S/C12H11NO2/c1-8(14)12-6-10(7-15-12)9-2-4-11(13)5-3-9/h2-7H,13H2,1H3 |
| InChIKey | IFVSHNBIVVSRCH-UHFFFAOYSA-N |
| Density | 1.175g/cm3 (Cal.) |
|---|---|
| Boiling point | 392.266°C at 760 mmHg (Cal.) |
| Flash point | 191.036°C (Cal.) |
| Refractive index | 1.585 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[4-(4-Aminophenyl)-2-furyl]ethanone |