|
CAS#: 90632-41-0 Product: beta-D-Aspartylaminomethylphosphonic acid No suppilers available for the product. |
| Name | beta-D-Aspartylaminomethylphosphonic acid |
|---|---|
| Synonyms | (2R)-4-Amino-4-Keto-2-(Phosphonomethylamino)Butyric Acid; Asp-Amp; D-Asparagine, N-(Phosphonomethyl)-, (R*,R*)-(-)- |
| Molecular Structure | ![]() |
| Molecular Formula | C5H11N2O6P |
| Molecular Weight | 226.13 |
| CAS Registry Number | 90632-41-0 |
| SMILES | [C@@H](C(=O)O)(NC[P](=O)(O)O)CC(=O)N |
| InChI | 1S/C5H11N2O6P/c6-4(8)1-3(5(9)10)7-2-14(11,12)13/h3,7H,1-2H2,(H2,6,8)(H,9,10)(H2,11,12,13)/t3-/m1/s1 |
| InChIKey | LFBBWSUAQUSSGN-GSVOUGTGSA-N |
| Density | 1.677g/cm3 (Cal.) |
|---|---|
| Boiling point | 651.482°C at 760 mmHg (Cal.) |
| Flash point | 347.804°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for beta-D-Aspartylaminomethylphosphonic acid |