|
CAS#: 906352-89-4 Product: 5-(2-Bromophenyl)-1-methyl-3-(trifluoromethyl)-1H-pyrazole No suppilers available for the product. |
| Name | 5-(2-Bromophenyl)-1-methyl-3-(trifluoromethyl)-1H-pyrazole |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H8BrF3N2 |
| Molecular Weight | 305.09 |
| CAS Registry Number | 906352-89-4 |
| SMILES | Cn1c(cc(n1)C(F)(F)F)c2ccccc2Br |
| InChI | 1S/C11H8BrF3N2/c1-17-9(6-10(16-17)11(13,14)15)7-4-2-3-5-8(7)12/h2-6H,1H3 |
| InChIKey | UKDUPCWWWMHDRH-UHFFFAOYSA-N |
| Density | 1.573g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.775°C at 760 mmHg (Cal.) |
| Flash point | 150.823°C (Cal.) |
| Refractive index | 1.559 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(2-Bromophenyl)-1-methyl-3-(trifluoromethyl)-1H-pyrazole |