| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 4,4,5,5-Tetramethyl-2-[(E)-2-(4-pentylphenyl)vinyl]-1,3,2-dioxaborolane |
|---|---|
| Synonyms | (E)-4,4,5 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H29BO2 |
| Molecular Weight | 300.24 |
| CAS Registry Number | 907626-13-5 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C2=CC=C(C=C2)CCCCC |
| InChI | 1S/C19H29BO2/c1-6-7-8-9-16-10-12-17(13-11-16)14-15-20-21-18(2,3)19(4,5)22-20/h10-15H,6-9H2,1-5H3/b15-14+ |
| InChIKey | ZNSXCABBRJIRGJ-CCEZHUSRSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 357.3±45.0°C at 760 mmHg (Cal.) |
| Flash point | 169.9±28.7°C (Cal.) |
| Refractive index | 1.5 (Cal.) |
| (1) | Afshin Dadvand, Wei-Hsin Sun, Andrey G. Moiseev, Francine Bélanger-Gariépy, Federico Rosei, Hong Meng and Dmitrii F. Perepichka. 1,5-, 2,6- and 9,10-distyrylanthracenes as luminescent organic semiconductors, J. Mater. Chem. C, 2013, 1, 2817. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4,4,5,5-Tetramethyl-2-[(E)-2-(4-pentylphenyl)vinyl]-1,3,2-dioxaborolane |