|
CAS#: 90799-56-7 Product: 7-Chloro-5-methylquinolin-8-ol No suppilers available for the product. |
| Name | 7-Chloro-5-methylquinolin-8-ol |
|---|---|
| Synonyms | 7-Chloro-5-Methyl-Quinolin-8-Ol; 7-Chloro-5-Methyl-8-Quinolinol |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8ClNO |
| Molecular Weight | 193.63 |
| CAS Registry Number | 90799-56-7 |
| EINECS | 292-680-2 |
| SMILES | C2=C(C1=C(N=CC=C1)C(=C2Cl)O)C |
| InChI | 1S/C10H8ClNO/c1-6-5-8(11)10(13)9-7(6)3-2-4-12-9/h2-5,13H,1H3 |
| InChIKey | ZIOISVUUZNUJNX-UHFFFAOYSA-N |
| Density | 1.35g/cm3 (Cal.) |
|---|---|
| Boiling point | 337.804°C at 760 mmHg (Cal.) |
| Flash point | 158.098°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Chloro-5-methylquinolin-8-ol |