|
CAS#: 908003-80-5 Product: Methyl (6,7-dimethoxy-1H-indol-3-yl)acetate No suppilers available for the product. |
| Name | Methyl (6,7-dimethoxy-1H-indol-3-yl)acetate |
|---|---|
| Synonyms | (6,7-Dimethoxy-1H-indol-3-yl)-acetic acid methyl ester |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.26 |
| CAS Registry Number | 908003-80-5 |
| SMILES | COc1ccc2c(c[nH]c2c1OC)CC(=O)OC |
| InChI | 1S/C13H15NO4/c1-16-10-5-4-9-8(6-11(15)17-2)7-14-12(9)13(10)18-3/h4-5,7,14H,6H2,1-3H3 |
| InChIKey | TUWWXGSJJVKHRM-UHFFFAOYSA-N |
| Density | 1.23g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.505°C at 760 mmHg (Cal.) |
| Flash point | 196.019°C (Cal.) |
| Refractive index | 1.584 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (6,7-dimethoxy-1H-indol-3-yl)acetate |