|
CAS#: 908211-94-9 Product: 1-O-Phosphono-beta-D-mannopyranose No suppilers available for the product. |
| Name | 1-O-Phosphono-beta-D-mannopyranose |
|---|---|
| Synonyms | dolichyl phosphate D-mannose; NCGC00013529; NSC-44138 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H13O9P |
| Molecular Weight | 260.14 |
| CAS Registry Number | 908211-94-9 |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@@H]([C@@H](O1)OP(=O)(O)O)O)O)O)O |
| InChI | 1S/C6H13O9P/c7-1-2-3(8)4(9)5(10)6(14-2)15-16(11,12)13/h2-10H,1H2,(H2,11,12,13)/t2-,3-,4+,5+,6+/m1/s1 |
| InChIKey | HXXFSFRBOHSIMQ-PQMKYFCFSA-N |
| Density | 1.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 603.0±65.0°C at 760 mmHg (Cal.) |
| Flash point | 318.5±34.3°C (Cal.) |
| Refractive index | 1.607 (Cal.) |
| (1) | Rahman M. Mizanur and Nicola L. B. Pohl. Phosphomannose isomerase/GDP-mannose pyrophosphorylase from Pyrococcus furiosus: a thermostable biocatalyst for the synthesis of guanidinediphosphate-activated and mannose-containing sugar nucleotides, Org. Biomol. Chem., 2009, 7, 2135. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-O-Phosphono-beta-D-mannopyranose |