Online Database of Chemicals from Around the World
|
CAS#: 90917-49-0 Product: Ethyl 4-hydroxy-3,5-diiodophenylacetate No suppilers available for the product. |
| Name | Ethyl 4-hydroxy-3,5-diiodophenylacetate |
|---|---|
| Synonyms | Ethyl 2-(4-Hydroxy-3,5-Diiodo-Phenyl)Acetate; 2-(4-Hydroxy-3,5-Diiodophenyl)Acetic Acid Ethyl Ester; 2-(4-Hydroxy-3,5-Diiodo-Phenyl)Acetic Acid Ethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C10H10I2O3 |
| Molecular Weight | 432.00 |
| CAS Registry Number | 90917-49-0 |
| EINECS | 292-689-1 |
| SMILES | C1=C(CC(OCC)=O)C=C(I)C(=C1I)O |
| InChI | 1S/C10H10I2O3/c1-2-15-9(13)5-6-3-7(11)10(14)8(12)4-6/h3-4,14H,2,5H2,1H3 |
| InChIKey | OICDFUWSAQEXEK-UHFFFAOYSA-N |
| Density | 2.146g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.457°C at 760 mmHg (Cal.) |
| Flash point | 159.703°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 4-hydroxy-3,5-diiodophenylacetate |