|
CAS#: 909674-82-4 Product: Methyl 4-{[4-({[6-(trifluoromethyl)-3-pyridinyl]methyl}amino)-1-piperidinyl]methyl}benzoate No suppilers available for the product. |
| Name | Methyl 4-{[4-({[6-(trifluoromethyl)-3-pyridinyl]methyl}amino)-1-piperidinyl]methyl}benzoate |
|---|---|
| Synonyms | methyl 4- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H24F3N3O2 |
| Molecular Weight | 407.43 |
| CAS Registry Number | 909674-82-4 |
| SMILES | FC(F)(F)c1ccc(cn1)CNC3CCN(Cc2ccc(cc2)C(=O)OC)CC3 |
| InChI | 1S/C21H24F3N3O2/c1-29-20(28)17-5-2-15(3-6-17)14-27-10-8-18(9-11-27)25-12-16-4-7-19(26-13-16)21(22,23)24/h2-7,13,18,25H,8-12,14H2,1H3 |
| InChIKey | WLXSDYYXAMTTJF-UHFFFAOYSA-N |
| Density | 1.275g/cm3 (Cal.) |
|---|---|
| Boiling point | 486.387°C at 760 mmHg (Cal.) |
| Flash point | 247.958°C (Cal.) |
| Refractive index | 1.559 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 4-{[4-({[6-(trifluoromethyl)-3-pyridinyl]methyl}amino)-1-piperidinyl]methyl}benzoate |