|
CAS#: 909709-18-8 Product: Ethyl 4-(cyclopentylamino)benzoate No suppilers available for the product. |
| Name | Ethyl 4-(cyclopentylamino)benzoate |
|---|---|
| Synonyms | 4-(Cyclopentylamino)benzoate d'éthyle; Benzoic acid, 4-(cyclopentylamino)-, ethyl ester |
| Molecular Structure | ![]() |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 |
| CAS Registry Number | 909709-18-8 |
| SMILES | CCOC(=O)c1ccc(cc1)NC2CCCC2 |
| InChI | 1S/C14H19NO2/c1-2-17-14(16)11-7-9-13(10-8-11)15-12-5-3-4-6-12/h7-10,12,15H,2-6H2,1H3 |
| InChIKey | CACXHWGMGDXLRW-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 368.3±25.0°C at 760 mmHg (Cal.) |
| Flash point | 176.5±23.2°C (Cal.) |
| Refractive index | 1.574 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 4-(cyclopentylamino)benzoate |