|
CAS#: 90991-90-5 Product: Spiro(Androstan-3,2'-Oxiran)-17-One No suppilers available for the product. |
| Name | Spiro(Androstan-3,2'-Oxiran)-17-One |
|---|---|
| Synonyms | 10,13-Dimethyl-17-Spiro[2,4,5,6,7,8,9,11,12,14,15,16-Dodecahydro-1H-Cyclopenta[A]Phenanthrene-3,2'-Oxirane]One; Nsc 307483; Spiro(Androstan-3,2'-Oxiran)-17-One |
| Molecular Structure | ![]() |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 |
| CAS Registry Number | 90991-90-5 |
| SMILES | CC35C2C(C1C(C(=O)CC1)(CC2)C)CCC3CC4(OC4)CC5 |
| InChI | 1S/C20H30O2/c1-18-9-10-20(12-22-20)11-13(18)3-4-14-15-5-6-17(21)19(15,2)8-7-16(14)18/h13-16H,3-12H2,1-2H3 |
| InChIKey | KLBDWUYEEAGQGW-UHFFFAOYSA-N |
| Density | 1.119g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.501°C at 760 mmHg (Cal.) |
| Flash point | 170.382°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Spiro(Androstan-3,2'-Oxiran)-17-One |