|
CAS#: 91-86-1 Product: 2,7-Dimethyl-2-(4,8,12-trimethyltridecyl)-6-chromanol No suppilers available for the product. |
| Name | 2,7-Dimethyl-2-(4,8,12-trimethyltridecyl)-6-chromanol |
|---|---|
| Synonyms | n-Tocopherol; η-tocopherol |
| Molecular Structure | ![]() |
| Molecular Formula | C27H46O2 |
| Molecular Weight | 402.65 |
| CAS Registry Number | 91-86-1 |
| SMILES | Oc2c(cc1OC(CCc1c2)(C)CCCC(C)CCCC(C)CCCC(C)C)C |
| InChI | 1S/C27H46O2/c1-20(2)10-7-11-21(3)12-8-13-22(4)14-9-16-27(6)17-15-24-19-25(28)23(5)18-26(24)29-27/h18-22,28H,7-17H2,1-6H3 |
| InChIKey | PZZKGQBMBVYPGR-UHFFFAOYSA-N |
| Density | 0.936g/cm3 (Cal.) |
|---|---|
| Boiling point | 505.548°C at 760 mmHg (Cal.) |
| Flash point | 200.956°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,7-Dimethyl-2-(4,8,12-trimethyltridecyl)-6-chromanol |