|
CAS#: 910037-16-0 Product: 2-[1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]benzoic acid No suppilers available for the product. |
| Name | 2-[1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]benzoic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H9F3N2O2 |
| Molecular Weight | 270.21 |
| CAS Registry Number | 910037-16-0 |
| SMILES | Cn1c(cc(n1)C(F)(F)F)c2ccccc2C(=O)O |
| InChI | 1S/C12H9F3N2O2/c1-17-9(6-10(16-17)12(13,14)15)7-4-2-3-5-8(7)11(18)19/h2-6H,1H3,(H,18,19) |
| InChIKey | ADEAPHCAMGDLFU-UHFFFAOYSA-N |
| Density | 1.407g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.947°C at 760 mmHg (Cal.) |
| Flash point | 177.538°C (Cal.) |
| Refractive index | 1.552 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]benzoic acid |