|
CAS#: 91092-19-2 Product: N,N-Bis(2-Chloroethyl)-3,4,5-Triiodo-Benzamide No suppilers available for the product. |
| Name | N,N-Bis(2-Chloroethyl)-3,4,5-Triiodo-Benzamide |
|---|---|
| Synonyms | N,N-Bis(2-Chloroethyl)-3,4,5-Triiodo-Benzamide; Benzamide, N,N-Bis(2-Chloroethyl)-3,4,5-Triiodo-; Nsc66347 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10Cl2I3NO |
| Molecular Weight | 623.83 |
| CAS Registry Number | 91092-19-2 |
| SMILES | C1=C(C(=C(C=C1C(N(CCCl)CCCl)=O)I)I)I |
| InChI | 1S/C11H10Cl2I3NO/c12-1-3-17(4-2-13)11(18)7-5-8(14)10(16)9(15)6-7/h5-6H,1-4H2 |
| InChIKey | HPCDOGZARWAKHI-UHFFFAOYSA-N |
| Density | 2.339g/cm3 (Cal.) |
|---|---|
| Boiling point | 570.438°C at 760 mmHg (Cal.) |
| Flash point | 298.79°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Bis(2-Chloroethyl)-3,4,5-Triiodo-Benzamide |