Online Database of Chemicals from Around the World
| Fluorochem Ltd. | UK | Inquire | ||
|---|---|---|---|---|
 |
+44 (1457) 860-111 | |||
 |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Name | Methyl 4-acetamido-2-methylbenzoate |
|---|---|
| Synonyms | 4-Acetylamino-2-methyl-benzoic acid methyl ester; Methyl 4-acetamido-2-methylbenzoate; Methyl 4-acetylamino-2-methylbenzate |
| Molecular Structure |  |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 |
| CAS Registry Number | 91133-71-0 |
| SMILES | Cc1cc(ccc1C(=O)OC)NC(=O)C |
| InChI | 1S/C11H13NO3/c1-7-6-9(12-8(2)13)4-5-10(7)11(14)15-3/h4-6H,1-3H3,(H,12,13) |
| InChIKey | SXVFWPMLEPDWEP-UHFFFAOYSA-N |
| Density | 1.173g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.022°C at 760 mmHg (Cal.) |
| Flash point | 178.188°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Methyl 4-acetamido-2-methylbenzoate |