Online Database of Chemicals from Around the World
|
CAS#: 91198-38-8 Product: 2,2'-{Sulfonylbis[(2,6-dichloro-4,1-phenylene)oxy]}diethanol No suppilers available for the product. |
| Name | 2,2'-{Sulfonylbis[(2,6-dichloro-4,1-phenylene)oxy]}diethanol |
|---|---|
| Synonyms | 2,2'-[sul |
| Molecular Structure | ![CAS#: 91198-38-8, 2,2'-{Sulfonylbis[(2,6-dichloro-4,1-phenylene)oxy]}diethanol](/moreStructures/91198-38-8.gif) |
| Molecular Formula | C16H14Cl4O6S |
| Molecular Weight | 476.16 |
| CAS Registry Number | 91198-38-8 |
| EINECS | 293-822-6 |
| SMILES | Clc1cc(cc(Cl)c1OCCO)S(=O)(=O)c2cc(Cl)c(OCCO)c(Cl)c2 |
| InChI | 1S/C16H14Cl4O6S/c17-11-5-9(6-12(18)15(11)25-3-1-21)27(23,24)10-7-13(19)16(14(20)8-10)26-4-2-22/h5-8,21-22H,1-4H2 |
| InChIKey | WINCTAVQOYZBMR-UHFFFAOYSA-N |
| Density | 1.579g/cm3 (Cal.) |
|---|---|
| Boiling point | 680.157°C at 760 mmHg (Cal.) |
| Flash point | 365.146°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-{Sulfonylbis[(2,6-dichloro-4,1-phenylene)oxy]}diethanol |