|
CAS#: 91224-36-1 Product: N-[(Z)-2-(4-Hydroxyphenyl)Ethenyl]Formamide No suppilers available for the product. |
| Name | N-[(Z)-2-(4-Hydroxyphenyl)Ethenyl]Formamide |
|---|---|
| Synonyms | N-[(Z)-2-(4-Hydroxyphenyl)Vinyl]Formamide; N-[(Z)-2-(4-Hydroxyphenyl)Ethenyl]Methanamide; Brn 2517467 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 |
| CAS Registry Number | 91224-36-1 |
| SMILES | C1=C(C=CC(=C1)O)\C=C/NC=O |
| InChI | 1S/C9H9NO2/c11-7-10-6-5-8-1-3-9(12)4-2-8/h1-7,12H,(H,10,11)/b6-5- |
| InChIKey | SOUPPVGWCZENNQ-WAYWQWQTSA-N |
| Density | 1.209g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.626°C at 760 mmHg (Cal.) |
| Flash point | 196.092°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(Z)-2-(4-Hydroxyphenyl)Ethenyl]Formamide |