|
CAS#: 912569-73-4 Product: N-Methyl-1-[1-methyl-5-phenoxy-3-(trifluoromethyl)-1H-pyrazol-4-yl]methanamine No suppilers available for the product. |
| Name | N-Methyl-1-[1-methyl-5-phenoxy-3-(trifluoromethyl)-1H-pyrazol-4-yl]methanamine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C13H14F3N3O |
| Molecular Weight | 285.27 |
| CAS Registry Number | 912569-73-4 |
| SMILES | CNCc1c(nn(c1Oc2ccccc2)C)C(F)(F)F |
| InChI | 1S/C13H14F3N3O/c1-17-8-10-11(13(14,15)16)18-19(2)12(10)20-9-6-4-3-5-7-9/h3-7,17H,8H2,1-2H3 |
| InChIKey | AJQKRVBDVZVOBK-UHFFFAOYSA-N |
| Density | 1.274g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.653°C at 760 mmHg (Cal.) |
| Flash point | 147.726°C (Cal.) |
| Refractive index | 1.524 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Methyl-1-[1-methyl-5-phenoxy-3-(trifluoromethyl)-1H-pyrazol-4-yl]methanamine |