|
CAS#: 91283-19-1 Product: N-(2,4-Dichlorobenzylidene)-alpha,alpha,alpha-Trifluoro-m-Toluidine No suppilers available for the product. |
| Name | N-(2,4-Dichlorobenzylidene)-alpha,alpha,alpha-Trifluoro-m-Toluidine |
|---|---|
| Synonyms | (2,4-Dichlorobenzylidene)-[3-(Trifluoromethyl)Phenyl]Amine; Nsc136285 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8Cl2F3N |
| Molecular Weight | 318.13 |
| CAS Registry Number | 91283-19-1 |
| SMILES | C1=CC=C(C(F)(F)F)C=C1N=CC2=C(Cl)C=C(Cl)C=C2 |
| InChI | 1S/C14H8Cl2F3N/c15-11-5-4-9(13(16)7-11)8-20-12-3-1-2-10(6-12)14(17,18)19/h1-8H |
| InChIKey | AHILDFMCWZMNBF-UHFFFAOYSA-N |
| Density | 1.334g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.103°C at 760 mmHg (Cal.) |
| Flash point | 181.261°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2,4-Dichlorobenzylidene)-alpha,alpha,alpha-Trifluoro-m-Toluidine |