|
CAS#: 91347-56-7 Product: 2-Amino-6-[(2-Methylphenyl)Amino]-5-Nitroso-1H-Pyrimidin-4-One No suppilers available for the product. |
| Name | 2-Amino-6-[(2-Methylphenyl)Amino]-5-Nitroso-1H-Pyrimidin-4-One |
|---|---|
| Synonyms | Nsc57056 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11N5O2 |
| Molecular Weight | 245.24 |
| CAS Registry Number | 91347-56-7 |
| SMILES | C1=CC=CC(=C1NC2=C(N=O)C(N=C(N2)N)=O)C |
| InChI | 1S/C11H11N5O2/c1-6-4-2-3-5-7(6)13-9-8(16-18)10(17)15-11(12)14-9/h2-5H,1H3,(H4,12,13,14,15,17) |
| InChIKey | FTBNJWZVDJCZKP-UHFFFAOYSA-N |
| Density | 1.514g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.942°C at 760 mmHg (Cal.) |
| Flash point | 182.978°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-6-[(2-Methylphenyl)Amino]-5-Nitroso-1H-Pyrimidin-4-One |