|
CAS#: 91391-68-3 Product: 1,2,2-Trimethylcyclohexan-1-Amine Hydrochloride No suppilers available for the product. |
| Name | 1,2,2-Trimethylcyclohexan-1-Amine Hydrochloride |
|---|---|
| Synonyms | 1,2,2-Trimethyl-1-Cyclohexanamine Hydrochloride; (1,2,2-Trimethylcyclohexyl)Amine Hydrochloride; 1,2,2-Trimethyl-1-Aminocyclohexane Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C9H20ClN |
| Molecular Weight | 177.72 |
| CAS Registry Number | 91391-68-3 |
| SMILES | [H+].CC1(C(N)(CCCC1)C)C.[Cl-] |
| InChI | 1S/C9H19N.ClH/c1-8(2)6-4-5-7-9(8,3)10;/h4-7,10H2,1-3H3;1H |
| InChIKey | BMQKLGWZPXOGPD-UHFFFAOYSA-N |
| Boiling point | 171.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 31.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,2-Trimethylcyclohexan-1-Amine Hydrochloride |