|
CAS#: 91423-90-4 Product: Isotrichodermin No suppilers available for the product. |
| Name | Isotrichodermin |
|---|---|
| Synonyms | Isotrichodermin; Tichothec-9-En-3-Ol, 12,13-Epoxy-, Acetate, (3Alpha)- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.37 |
| CAS Registry Number | 91423-90-4 |
| SMILES | [C@H]13O[C@H]4[C@@](C(C12OC2)(C[C@H]3OC(=O)C)C)(CCC(=C4)C)C |
| InChI | 1S/C17H24O4/c1-10-5-6-15(3)13(7-10)21-14-12(20-11(2)18)8-16(15,4)17(14)9-19-17/h7,12-14H,5-6,8-9H2,1-4H3/t12-,13-,14-,15+,16?,17?/m1/s1 |
| InChIKey | OZXJPPYWZVBMGW-DJXIOKRSSA-N |
| Density | 1.192g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.232°C at 760 mmHg (Cal.) |
| Flash point | 160.98°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isotrichodermin |