|
CAS#: 91488-26-5 Product: Retinylidene Methylnitrone No suppilers available for the product. |
| Name | Retinylidene Methylnitrone |
|---|---|
| Synonyms | (2Z,4E,6E,8E)-N,3,7-Trimethyl-9-(2,6,6-Trimethyl-1-Cyclohexenyl)Nona-2,4,6,8-Tetraen-1-Imine Oxide; Methanamine, N-(3,7-Dimethyl-9-2,6,6-Trimethyl-1-Cyclohexen-1-Yl)-2,4,6,8-Nonatraenylidene)-,N-Oxide, (All-E)-; All-Trans-Retinylidene Methyl Nitrone |
| Molecular Structure | ![]() |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.48 |
| CAS Registry Number | 91488-26-5 |
| SMILES | C[N+]([O-])=CC=C(C)C=CC=C(C)C=CC1=C(CCCC1(C)C)C |
| InChI | 1S/C21H31NO/c1-17(9-7-10-18(2)14-16-22(6)23)12-13-20-19(3)11-8-15-21(20,4)5/h7,9-10,12-14,16H,8,11,15H2,1-6H3 |
| InChIKey | UMERTAMONDFPRZ-UHFFFAOYSA-N |
| Density | 0.955g/cm3 (Cal.) |
|---|---|
| Boiling point | 461.948°C at 760 mmHg (Cal.) |
| Flash point | 193.19°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Retinylidene Methylnitrone |