|
CAS#: 915019-18-0 Product: N-[(2-Hydroxyphenyl)(3-nitrophenyl)methyl]acetamide No suppilers available for the product. |
| Name | N-[(2-Hydroxyphenyl)(3-nitrophenyl)methyl]acetamide |
|---|---|
| Synonyms | N-[(2-Hydroxy-phenyl)-(3-nitro-phenyl)-methyl]-acetamide |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.28 |
| CAS Registry Number | 915019-18-0 |
| SMILES | CC(=O)NC(c1cccc(c1)N(=O)=O)c2ccccc2O |
| InChI | 1S/C15H14N2O4/c1-10(18)16-15(13-7-2-3-8-14(13)19)11-5-4-6-12(9-11)17(20)21/h2-9,15,19H,1H3,(H,16,18) |
| InChIKey | KYLJJWGBNACZPH-UHFFFAOYSA-N |
| Density | 1.308g/cm3 (Cal.) |
|---|---|
| Boiling point | 548.495°C at 760 mmHg (Cal.) |
| Flash point | 285.52°C (Cal.) |
| Refractive index | 1.62 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(2-Hydroxyphenyl)(3-nitrophenyl)methyl]acetamide |