|
CAS#: 915402-35-6 Product: 6-Chloro-Quinazoline-2,4-Diamine No suppilers available for the product. |
| Name | 6-Chloro-Quinazoline-2,4-Diamine |
|---|---|
| Synonyms | (2-Amino-6-Chloro-Quinazolin-4-Yl)Amine; 6-Chloro-Quinazoline-2,4-Diamine; Nsc82703 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7ClN4 |
| Molecular Weight | 194.62 |
| CAS Registry Number | 915402-35-6 (18671-95-9) |
| SMILES | C2=C1C(=NC(=NC1=CC=C2Cl)N)N |
| InChI | 1S/C8H7ClN4/c9-4-1-2-6-5(3-4)7(10)13-8(11)12-6/h1-3H,(H4,10,11,12,13) |
| InChIKey | ZMQPXDMCQOHVLV-UHFFFAOYSA-N |
| Density | 1.538g/cm3 (Cal.) |
|---|---|
| Boiling point | 488.825°C at 760 mmHg (Cal.) |
| Flash point | 249.433°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-Quinazoline-2,4-Diamine |