|
CAS#: 91636-50-9 Product: 2-Dimethylamino-2-Phenyl-Butanimidamide No suppilers available for the product. |
| Name | 2-Dimethylamino-2-Phenyl-Butanimidamide |
|---|---|
| Synonyms | 2-Dimethylamino-2-Phenyl-Butanamidine; 2-Dimethylamino-2-Phenylbutanamidine; 2-Dimethylamino-2-Phenyl-Butyramidine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 |
| CAS Registry Number | 91636-50-9 |
| SMILES | C1=CC=CC=C1C(C(N)=N)(CC)N(C)C |
| InChI | 1S/C12H19N3/c1-4-12(11(13)14,15(2)3)10-8-6-5-7-9-10/h5-9H,4H2,1-3H3,(H3,13,14) |
| InChIKey | DWHSFAHUKWWLSI-UHFFFAOYSA-N |
| Density | 1.005g/cm3 (Cal.) |
|---|---|
| Boiling point | 291.818°C at 760 mmHg (Cal.) |
| Flash point | 130.287°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Dimethylamino-2-Phenyl-Butanimidamide |