|
CAS#: 91679-67-3 Product: 2-Chloromethylfluorene No suppilers available for the product. |
| Name | 2-Chloromethylfluorene |
|---|---|
| Synonyms | 2-Chloromethylfluorene |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11Cl |
| Molecular Weight | 214.69 |
| CAS Registry Number | 91679-67-3 |
| SMILES | C1=C(C=CC2=C1CC3=C2C=CC=C3)CCl |
| InChI | 1S/C14H11Cl/c15-9-10-5-6-14-12(7-10)8-11-3-1-2-4-13(11)14/h1-7H,8-9H2 |
| InChIKey | ZRIDXJOGXXKCEK-UHFFFAOYSA-N |
| Density | 1.22g/cm3 (Cal.) |
|---|---|
| Boiling point | 359.288°C at 760 mmHg (Cal.) |
| Flash point | 162.902°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloromethylfluorene |