Online Database of Chemicals from Around the World
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (650) 278-9963 | |||
 |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | Tetrakis(1,2,2,6,6-pentamethyl-4-piperidinyl) 1,2,3,4-butanetetracarboxylate |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C48H86N4O8 |
| Molecular Weight | 847.22 |
| CAS Registry Number | 91788-83-9 |
| SMILES | CC1(C)CC(CC(C)(C)N1C)OC(=O)C(CC(=O)OC2CC(C)(C)N(C)C(C)(C)C2)C(CC(=O)OC3CC(C)(C)N(C)C(C)(C)C3)C(=O)OC4CC(C)(C)N(C)C(C)(C)C4 |
| InChI | 1S/C48H86N4O8/c1-41(2)23-31(24-42(3,4)49(41)17)57-37(53)21-35(39(55)59-33-27-45(9,10)51(19)46(11,12)28-33)36(40(56)60-34-29-47(13,14)52(20)48(15,16)30-34)22-38(54)58-32-25-43(5,6)50(18)44(7,8)26-32/h31-36H,21-30H2,1-20H3 |
| InChIKey | WUPCFMITFBVJMS-UHFFFAOYSA-N |
| Density | 1.093g/cm3 (Cal.) |
|---|---|
| Boiling point | 740.108°C at 760 mmHg (Cal.) |
| Flash point | 401.403°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tetrakis(1,2,2,6,6-pentamethyl-4-piperidinyl) 1,2,3,4-butanetetracarboxylate |