|
CAS#: 91811-98-2 Product: Pyruvic Acid Thiosemicarbazone-Platinum Complex No suppilers available for the product. |
| Name | Pyruvic Acid Thiosemicarbazone-Platinum Complex |
|---|---|
| Synonyms | (2Z)-2-(Carbamothioylhydrazono)Propanoate; Platinum(+2) Cation; Platinum(+2) Cation; (2Z)-2-(Thiocarbamoylhydrazono)Propionate; Pat-Pt Complex |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12N6O4PtS2 |
| Molecular Weight | 515.43 |
| CAS Registry Number | 91811-98-2 |
| SMILES | [Pt++].C/C(=N/NC(=S)N)C([O-])=O.C/C(=N/NC(=S)N)C([O-])=O |
| InChI | 1S/2C4H7N3O2S.Pt/c2*1-2(3(8)9)6-7-4(5)10;/h2*1H3,(H,8,9)(H3,5,7,10);/q;;+2/p-2/b2*6-2-; |
| InChIKey | FCISTAFJLKLCQE-HRFVTYMNSA-L |
| Boiling point | 335.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 156.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pyruvic Acid Thiosemicarbazone-Platinum Complex |