|
CAS#: 918149-79-8 Product: (3R)-3-(4-Bromophenyl)-4-pentenoic acid No suppilers available for the product. |
| Name | (3R)-3-(4-Bromophenyl)-4-pentenoic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H11BrO2 |
| Molecular Weight | 255.11 |
| CAS Registry Number | 918149-79-8 |
| SMILES | Brc1ccc(cc1)[C@@H](/C=C)CC(=O)O |
| InChI | 1S/C11H11BrO2/c1-2-8(7-11(13)14)9-3-5-10(12)6-4-9/h2-6,8H,1,7H2,(H,13,14)/t8-/m0/s1 |
| InChIKey | LLLUYSJNSQAPTD-QMMMGPOBSA-N |
| Density | 1.43g/cm3 (Cal.) |
|---|---|
| Boiling point | 359.142°C at 760 mmHg (Cal.) |
| Flash point | 171.003°C (Cal.) |
| Refractive index | 1.571 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3R)-3-(4-Bromophenyl)-4-pentenoic acid |