|
CAS#: 91874-98-5 Product: 2-(3,4-Dihydroxyphenyl)Naphtho[1,2-d]Thiazole No suppilers available for the product. |
| Name | 2-(3,4-Dihydroxyphenyl)Naphtho[1,2-d]Thiazole |
|---|---|
| Synonyms | (4Z)-4-(1H-Benzo[E][1,3]Benzothiazol-2-Ylidene)-2-Hydroxy-Cyclohexa-2,5-Dien-1-One; (4Z)-4-(1H-Benzo[E][1,3]Benzothiazol-2-Ylidene)-2-Hydroxy-1-Cyclohexa-2,5-Dienone; 2-(3,4-Dihydroxyphenyl)Naphtho(1,2-D)Thiazole |
| Molecular Structure | ![]() |
| Molecular Formula | C17H11NO2S |
| Molecular Weight | 293.34 |
| CAS Registry Number | 91874-98-5 |
| SMILES | C2=CC1=CC=CC=C1C3=C2SC(/N3)=C4\C=C(O)C(=O)C=C4 |
| InChI | 1S/C17H11NO2S/c19-13-7-5-11(9-14(13)20)17-18-16-12-4-2-1-3-10(12)6-8-15(16)21-17/h1-9,18,20H/b17-11- |
| InChIKey | IRTSDEINKFGBIC-BOPFTXTBSA-N |
| Density | 1.5g/cm3 (Cal.) |
|---|---|
| Boiling point | 434.156°C at 760 mmHg (Cal.) |
| Flash point | 216.37°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3,4-Dihydroxyphenyl)Naphtho[1,2-d]Thiazole |