|
CAS#: 919119-71-4 Product: 2-Phenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole No suppilers available for the product. |
| Name | 2-Phenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
|---|---|
| Synonyms | 1H-Indole |
| Molecular Structure | ![]() |
| Molecular Formula | C20H22BNO2 |
| Molecular Weight | 319.21 |
| CAS Registry Number | 919119-71-4 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)c2cccc3c2[nH]c(c3)c4ccccc4 |
| InChI | 1S/C20H22BNO2/c1-19(2)20(3,4)24-21(23-19)16-12-8-11-15-13-17(22-18(15)16)14-9-6-5-7-10-14/h5-13,22H,1-4H3 |
| InChIKey | DXVZBMDOCREPDQ-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 506.7±30.0°C at 760 mmHg (Cal.) |
| Flash point | 260.2±24.6°C (Cal.) |
| Refractive index | 1.606 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Phenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |