|
CAS#: 91956-02-4 Product: Ethyl 3-methyl-5-(4-nitrophenyl)-1,2-oxazole-4-carboxylate No suppilers available for the product. |
| Name | Ethyl 3-methyl-5-(4-nitrophenyl)-1,2-oxazole-4-carboxylate |
|---|---|
| Synonyms | 4-Isoxazo |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.24 |
| CAS Registry Number | 91956-02-4 |
| SMILES | CCOC(=O)c1c(noc1c2ccc(cc2)[N+](=O)[O-])C |
| InChI | 1S/C13H12N2O5/c1-3-19-13(16)11-8(2)14-20-12(11)9-4-6-10(7-5-9)15(17)18/h4-7H,3H2,1-2H3 |
| InChIKey | HNDPDVGKBPGDPL-UHFFFAOYSA-N |
| Density | 1.295g/cm3 (Cal.) |
|---|---|
| Boiling point | 442.485°C at 760 mmHg (Cal.) |
| Flash point | 221.407°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 3-methyl-5-(4-nitrophenyl)-1,2-oxazole-4-carboxylate |