|
CAS#: 92-20-6 Product: 2',5'-Dimethoxy-4'-nitrobenzanilide No suppilers available for the product. |
| Name | 2',5'-Dimethoxy-4'-nitrobenzanilide |
|---|---|
| Synonyms | N-(2,5-Dimethoxy-4-Nitro-Phenyl)Benzamide; 2',5'-Dimethoxy-4'-Nitrobenzanilide |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14N2O5 |
| Molecular Weight | 302.29 |
| CAS Registry Number | 92-20-6 |
| EINECS | 202-135-2 |
| SMILES | C2=C(NC(=O)C1=CC=CC=C1)C(=CC(=C2OC)[N+]([O-])=O)OC |
| InChI | 1S/C15H14N2O5/c1-21-13-9-12(17(19)20)14(22-2)8-11(13)16-15(18)10-6-4-3-5-7-10/h3-9H,1-2H3,(H,16,18) |
| InChIKey | JCKZOGUHQXHGTO-UHFFFAOYSA-N |
| Density | 1.325g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.07°C at 760 mmHg (Cal.) |
| Flash point | 204.827°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2',5'-Dimethoxy-4'-nitrobenzanilide |