|
CAS#: 92007-58-4 Product: (1S)-2-Methylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid No suppilers available for the product. |
| Name | (1S)-2-Methylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| Synonyms | (1S)-2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 |
| CAS Registry Number | 92007-58-4 |
| SMILES | CC1(CC2C[C@H]1C=C2)C(=O)O |
| InChI | 1S/C9H12O2/c1-9(8(10)11)5-6-2-3-7(9)4-6/h2-3,6-7H,4-5H2,1H3,(H,10,11)/t6?,7-,9?/m1/s1 |
| InChIKey | JIHFJSOMLKXSSQ-KDIYEYIXSA-N |
| Density | 1.178g/cm3 (Cal.) |
|---|---|
| Boiling point | 261.352°C at 760 mmHg (Cal.) |
| Flash point | 121.096°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1S)-2-Methylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid |